Elemicin 5.0g | #121a
5.0g of Elemicin
Not available where scheduled unless permit is provided. Review the laws in your country before ordering.
| Chemical Name | elemicin, 5-Allyl-1,2,3-trimethoxybenzene |
| Purity | ≥98% |
| Packaging | under Argon in container |
| Appearance | liquid |
| CAS# | 487-11-6 |
| Melting Point | N/A |
| Molecular Weight | 208.254 g/mol |
| Molecular Formula | C12H16O3 |
| Solubility | slightly soluble in water, DMSO, etc. |
| Storage | Store in a tightly sealed container in a cool, dry area. |
SMILES: COc1cc(cc(c1OC)OC)CC=C
InChI=1S/C12H16O3/c1-5-6-9-7-10(13-2)12(15-4)11(8-9)14-3/h5,7-8H,1,6H2,2-4H3
InChIKey= BPLQKQKXWHCZSS-UHFFFAOYSA-N
For research purposes. Not for use in-vivo.
3rd Party Analysis;
MSDS; https://syntharise.com/wp-content/uploads/2022/06/elemicin-1.pdf
Links for further data on Elemicin:
http://www.chemspider.com/Chemical-Structure.9830.html?rid=007ff375-51ba-4f3a-8d7e-4cbcca252eba
