5-Fluoro-NiPT/5-Fluoro-iPT 1.0g | #241c
1.0g bulk 5-Fluoro-IPT - This is a structural isomer of; 5-Fluoro-MET "Bretisilocin", with very similar profile of receptor binding affinity to 5-HT receptors, etc.
Not available where scheduled unless permit is provided. Review the laws in your country before ordering.
| Chemical Name | 5-F-iPT freebase 5-Fluoro-NiPT/5-Fluoro-iPT, [2-(5-fluoro-1H-indol-3-yl)ethyl](propan-2-yl)amine |
| Purity | ≥98% |
| Packaging | In a UV resistant bag. |
| Appearance | granular solid, off-white/tan |
| CAS# | N/A |
| Melting Point | N/A |
| Molecular Weight | 220.29g/mol |
| Molecular Formula |
C13H17FN2 |
| Solubility | soluble in methanol, DMSO, EtOAc, etc. |
| Storage | Store in a tightly sealed container in a cool, dry area. |
InChI=1S/C13H17FN2/c1-9(2)15-6-5-10-8-16-13-4-3-11(14)7-12(10)13/h3-4,7-9,15-16H,5-6H2,1-2H3
InChIKey=YVSGTVHUOVQSAT-UHFFFAOYSA-N
CC(C)NCCC1=CNC2=C1C=C(F)C=C2
For research purposes. Not for use in-vivo.
3rd Party Analysis;
MSDS;
