Phenprobamate 5.0g | #104a
Phenprobamate 5.0g
Not available where scheduled unless permit is provided. Review the laws in your country before ordering.
| Chemical Name | 3-Phenylpropyl carbamate |
| Purity | ≥99% |
| Packaging | In a UV resistant bag. |
| Appearance | White Powder |
| CAS# | 673-31-4 |
| Melting Point | N/A |
| Molecular Weight | 179.216g/mol |
| Molecular Formula | C10H13NO2 |
| Solubility | Soluble in methanol, ethanol, DMSO, etc. |
| Storage | Store in a tightly sealed container in a cool, dry area. |
SMILES:c1ccc(cc1)CCCOC(=O)N
InChI=1S/C10H13NO2/c11-10(12)13-8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H2,11,12)
InChIKey=CAMYKONBWHRPDD-UHFFFAOYSA-N
For research purposes. Not for use in-vivo.
3rd Party Analysis;Phenprobamate
MSDS; MSDS of phenprobamate
