Capsaicin 95%+ 5.0g | #108b
5.0 Grams of Capsaicin
Not available where scheduled unless permit is provided. Review the laws in your country before ordering.
| Chemical Name | (6E)-N-(4-Hydroxy-3-methoxybenzyl)-8-methyl-6-nonenamide |
| Purity | ≥95% |
| Packaging | In a UV resistant bag. |
| Appearance | White Powder |
| CAS# | 404-86-4 |
| Melting Point | N/A |
| Molecular Weight | 305.412 g/mol |
| Molecular Formula | C18H27NO3 |
| Solubility | Soluble in alcohol, DMSO, etc. |
| Storage | Store in a tightly sealed container in a cool, dry area. |
SMILES CC(C)/C=C/CCCC/C(=N/Cc1ccc(c(c1)OC)O)/O
InChI=1S/C18H27NO3/c1-14(2)8-6-4-5-7-9-18(21)19-13-15-10-11-16(20)17(12-15)22-3/h6,8,10-12,14,20H,4-5,7,9,13H2,1-3H3,(H,19,21)/b8-6+
InChIKey YKPUWZUDDOIDPM-SOFGYWHQSA-N
For research purposes. Not for use in-vivo.
3rd Party Analysis; Capsaicin H-NMR
MSDS; capsaicin MSDS
Links:
