Bromantane 20g | #067c
20.0g of Bromantane
Not available to countries where scheduled. Review the laws in your country before ordering.
| Chemical Name | Bromantane, N-(4-bromophenyl)adamantan-2-amine |
| Purity | ≥98% |
| Packaging | In a UV resistant bag. |
| Appearance | Off-White Powder |
| CAS# | 87913-26-6 |
| Melting Point | N/A |
| Molecular Weight | 306.247g/mol |
| Molecular Formula | C16H20BrN |
| Solubility | Soluble in DMSO |
| Storage | Store in a tightly sealed container in a cool, dry area. |
SMILES: c1cc(ccc1NC2C3CC4CC(C3)CC2C4)Br
InChI=1S/C16H20BrN/c17-14-1-3-15(4-2-14)18-16-12-6-10-5-11(8-12)9-13(16)7-10/h1-4,10-13,16,18H,5-9H2
LWJALJDRFBXHKX-UHFFFAOYSA-N
For research purposes. Not for use in-vivo.
3rd Party Analysis: Bromantane
MSDS: Bromantane
Links for further data on Bromantane:
http://www.chemspider.com/Chemical-Structure.3849628.html?rid=d2ac84cb-76e5-4f39-becc-f01f6351e165
