4-methylphenmetrazine HCl 2.5g | #063b
2.5g of 4-methylphenmetrazine HCl
Not available to countries where scheduled. Review the laws in your country before ordering.
| Chemical Name | 4-methylphenmetrazine HCl, 3-methyl-2-(4-methylphenyl)morpholine HCl |
| Purity | ≥98% |
| Packaging | In a UV resistant bag. |
| Appearance | White Powder |
| CAS# | 1496165-49-1 |
| Melting Point | N/A |
| Molecular Weight | 227.73g/mol |
| Molecular Formula | C12H17NO.ClH |
| Solubility | Soluble in Ethanol, DMSO, DMF, H2O |
| Storage | Store in a tightly sealed container in a cool, dry area. |
InChI=1S/C12H17NO/c1-9-3-5-11(6-4-9)12-10(2)13-7-8-14-12/h3-6,10,12-13H,7-8H2,1-2H3
InChI Key; NWNCIXFIIDVRKE-UHFFFAOYSA-N
For research purposes. Not for use in-vivo.
3rd Party Analysis: H-NMR 4-methylphenmetrazine HCl
