4-F-TNB3Me 100mg | #290a
Buy 4-F-TNB3Me
100mg of 4-F-TNB3Me (97%+ purity)
Not available where scheduled unless permit is provided. Review the laws in your country before ordering.
| Chemical Name | 4-F-TNB3Me [2-(4-fluoro-1H-indol-3-yl)ethyl][(3-methylphenyl)methyl]amine |
| Purity | ≥97% |
| Packaging | In a UV resistant bag. |
| Appearance | amber/light brown solid |
| CAS# | N/A |
| Melting Point | N/A |
| Molecular Weight | 282.36g/mol |
| Molecular Formula |
C18H19FN2 |
| Solubility | soluble in methanol, DMSO, etc. |
| Storage | Store in a tightly sealed container in a cool, dry area. |
CC1=CC(CNCCC2=CNC3=C2C(F)=CC=C3)=CC=C1
InChI=1S/C18H19FN2/c1-13-4-2-5-14(10-13)11-20-9-8-15-12-21-17-7-3-6-16(19)18(15)17/h2-7,10,12,20-21H,8-9,11H2,1H3
InChIKey=BHDYFEVBFVKQFX-UHFFFAOYSA-N
For research purposes. Not for use in-vivo.
3rd Party Analysis;
MSDS;
