3,4-dichlorophenmetrazine HCl 5.0g | #111c
3,4-dichlorophenmetrazine. Buy 5.0g; 3,4-dichlorophenmetrazine HCl - 5-HT agonist and Dopamine agonist, 98%+ purity, white chunks/powder.
Not available where scheduled unless permit is provided. Review the laws in your country before ordering.
| Chemical Name | 2-(3,4-dichlorophenyl)-3-methylmorpholine hydrochloride |
| Purity | ≥98% |
| Packaging | In a UV resistant bag. |
| Appearance | White Powder |
| CAS# | N/A |
| Melting Point | N/A |
| Molecular Weight | 282.59 g/mol |
| Molecular Formula | C11H13Cl2NO.ClH |
| Solubility | Soluble in water, alcohol, DMSO, etc. |
| Storage | Store in a tightly sealed container in a cool, dry area. |
SMILES Cl.CC1NCCOC1C1=CC(Cl)=C(Cl)C=C1
InChI=1/C11H13Cl2NO.ClH/c1-7-11(15-5-4-14-7)8-2-3-9(12)10(13)6-8;/h2-3,6-7,11,14H,4-5H2,1H3;1H
InChIKey=GMQHUYCQKHNIGD-UHFFFAOYNA-N
For research purposes. Not for use in-vivo.
3rd Party Analysis; 3,4-dichlorophenmetrazine HCl H-NMR
MSDS; 3,4-dichlorophenmetrazine HCl MSDS
