3-Methoxyphenmetrazine HCl 2.5g | #066b
2.5g of 3-Methoxyphenmetrazine HCl
Not available to countries where scheduled. Review the laws in your country before ordering.
| Chemical Name | 3-Methoxyphenmetrazine HCl, 2-(3-methoxyphenyl)-3-methylmorpholine HCl |
| Purity | ≥98% |
| Packaging | In a UV resistant bag. |
| Appearance | Off-White Powder |
| CAS# | N/A |
| Melting Point | N/A |
| Molecular Weight | 243.73g/mol |
| Molecular Formula | C12H17NO2.ClH |
| Solubility | Soluble in DMSO, H2O, Methanol |
| Storage | Store in a tightly sealed container in a cool, dry area. |
InChI=1s/C12H17NO2.ClH/c1-9-12(15-7-6-13-9)10-4-3-5-11(8-10)14-2;h3-5,8-9,12-13H,6-7H2,1-2H3;1H
InChI Key: JGSWOTXOKOKMJO-UHFFFAOYSA-N
For research purposes. Not for use in-vivo.
3rd Party Analysis: HNMR of 3-methoxyphenmetrazine HCl
MSDS; MSDS 3-methoxyphenmetrazine HCl
