3-Iodophenmetrazine HCl 1.0g | #133a
3-Iodophenmetrazine HCl, quantity: 1.0 gram
3-IPM is a rare substituted phenmetrazine for study that can be related to 5-IAI, for research involving potential as a non-neurotoxic chemical. This is for in-vitro screening use and other purposes in the chemistry sector.
Not available where scheduled unless permit is provided. Review the laws in your country before ordering.
| Chemical Name | 2-(3-iodophenyl)-3-methylmorpholine hydrochloride, 3-IPM (HCl) |
| Purity | ≥98% |
| Packaging | under Argon in container |
| Appearance | White Powder |
| CAS# | N/A |
| Melting Point | N/A |
| Molecular Weight | 339.60g/mol |
| Molecular Formula | C11H15ClINO |
| Solubility | soluble in water, DMSO, etc. |
| Storage | Store in a tightly sealed container in a cool, dry area. |
Cl.CC1NCCOC1C1=CC(I)=CC=C1
InChI=1/C11H14INO.ClH/c1-8-11(14-6-5-13-8)9-3-2-4-10(12)7-9;/h2-4,7-8,11,13H,5-6H2,1H3;1H
InChIKey=CESFSKNGJLJNMI-UHFFFAOYNA-N
For research purposes. Not for use in-vivo.
3rd Party Analysis;
MSDS:
