N-Me-322PEP-AcO 100mg | #287a
Buy N-Me-322PEP-AcO
100mg of N-Me-322PEP-AcO (95%+ purity)
Not available where scheduled unless permit is provided. Review the laws in your country before ordering.
| Chemical Name | N-Me-322PEP-AcO 3-[2-(1-methylpiperidin-2-yl)ethyl]phenyl acetate |
| Purity | ≥95% |
| Packaging | In a UV resistant bag. |
| Appearance | off-white solid |
| CAS# | N/A |
| Melting Point | N/A |
| Molecular Weight | 261.37g/mol |
| Molecular Formula |
C16H23NO2 |
| Solubility | soluble in methanol, DMSO, etc. |
| Storage | Store in a tightly sealed container in a cool, dry area. |
CN1CCCCC1CCC1=CC(OC(C)=O)=CC=C1
InChI=1/C16H23NO2/c1-13(18)19-16-8-5-6-14(12-16)9-10-15-7-3-4-11-17(15)2/h5-6,8,12,15H,3-4,7,9-11H2,1-2H3
InChIKey=QSDPRLRSXUWIOK-UHFFFAOYNA-N
For research purposes. Not for use in-vivo.
3rd Party Analysis;
MSDS;
