N-Me-322PEP 100mg | #286a
Buy N-Me-322PEP
100mg of N-Me-322PEP (97%+ purity)
Not available where scheduled unless permit is provided. Review the laws in your country before ordering.
| Chemical Name | N-Me-322PEP 3-[2-(1-methylpiperidin-2-yl)ethyl]phenol |
| Purity | ≥97% |
| Packaging | In a UV resistant bag. |
| Appearance | off-white solid |
| CAS# | N/A |
| Melting Point | N/A |
| Molecular Weight | 219.33g/mol |
| Molecular Formula |
C14H21NO |
| Solubility | soluble in methanol, DMSO, etc. |
| Storage | Store in a tightly sealed container in a cool, dry area. |
CN1CCCCC1CCC1=CC(O)=CC=C1
InChI=1/C14H21NO/c1-15-10-3-2-6-13(15)9-8-12-5-4-7-14(16)11-12/h4-5,7,11,13,16H,2-3,6,8-10H2,1H3
InChIKey=CWEVLZMZAUYVLM-UHFFFAOYNA-N
For research purposes. Not for use in-vivo.
3rd Party Analysis;

MSDS;
