5-Fluoro-MALT (freebase) 500mg | #268a
Buy; 500mg of 5-Fluoro-MALT- a 5-fluoro dialkylated tryptamine substitution. (H-NMR analyzed and approved)
Not available where scheduled unless permit is provided. Review the laws in your country before ordering.
| Chemical Name | [2-(5-fluoro-1H-indol-3-yl)ethyl](methyl)(prop-2-en-1-yl)amine 5-F-MALT |
| Purity | ≥98% |
| Packaging | In a UV resistant bag. |
| Appearance | tan/brown solid |
| CAS# | N/A |
| Melting Point | N/A |
| Molecular Weight | 232.30 g/mol (freebase) |
| Molecular Formula |
C14H17FN2 |
| Solubility | soluble in methanol, DMSO, etc. |
| Storage | Store in a tightly sealed container in a cool, dry area. |
CN(CCC1=CNC2=C1C=C(F)C=C2)CC=C
InChI=1S/C14H17FN2/c1-3-7-17(2)8-6-11-10-16-14-5-4-12(15)9-13(11)14/h3-5,9-10,16H,1,6-8H2,2H3
InChIKey=HOZUDEIPSIFLME-UHFFFAOYSA-N
For research purposes. Not for use in-vivo.
3rd Party Analysis;
MSDS;
