5-MeO-MET (freebase) 500mg | #267a
Buy 500mg of 5-Methoxy-MET- a tertiary amine /dialkylated tryptamine with N-ethyl-N-methyl substitution. (Well known from others, like; 4-HO-MET, etc.)
Not available where scheduled unless permit is provided. Review the laws in your country before ordering.
| Chemical Name |
5-MeO-MET freebase 5-Methoxy-MET, |
| Purity | ≥98% |
| Packaging | In a UV resistant bag. |
| Appearance | tan/light brown solid |
| CAS# | N/A |
| Melting Point | N/A |
| Molecular Weight | 232.33 g/mol (freebase) |
| Molecular Formula |
C14H20N2O |
| Solubility | soluble in methanol, DMSO, etc. |
| Storage | Store in a tightly sealed container in a cool, dry area. |
CCN(C)CCC1=CNC2=C1C=C(OC)C=C2
InChIKey=AVECDEWGCOLCPZ-UHFFFAOYSA-N
InChI=1S/C14H20N2O/c1-4-16(2)8-7-11-10-15-14-6-5-12(17-3)9-13(11)14/h5-6,9-10,15H,4,7-8H2,1-3H3
For research purposes. Not for use in-vivo.
3rd Party Analysis;
MSDS;
