6-Fluoro-isoPropylTryptoline HCl (6-Fluoro-iPTHBC) 1000mg | #246c
Buy bulk pure, crystalline; 1.0g of 6-Fluoro-iPTHBC, 6-Fluoro-isopropyltryptoline HCl
Not available where scheduled unless permit is provided. Review the laws in your country before ordering.
| Chemical Name | 6-Fluoro-isopropyltryptoline HCl, 6-fluoro-1-(propan-2-yl)-1H,2H,3H,4H,9H-pyrido[3,4-b]indole hydrochloride 6-Fluoro-iPTHBC |
| Purity | ≥98% |
| Packaging | In a UV resistant bag. |
| Appearance | slightly beige crystals |
| CAS# | N/A |
| Melting Point | N/A |
| Molecular Weight | 268.76g/mol |
| Molecular Formula | C14H18ClFN2 |
| Solubility | Soluble in; water, DMSO, methanol, etc. |
| Storage | Store in a tightly sealed container in a cool, dry area. |
InChI=1/C14H17FN2.ClH/c1-8(2)13-14-10(5-6-16-13)11-7-9(15)3-4-12(11)17-14;/h3-4,7-8,13,16-17H,5-6H2,1-2H3;1H
InChIKey=CWXBSOVEPZDUAX-UHFFFAOYNA-N
CC(C)C1C2=C(CCN1)C3=C(N2)C=CC(=C3)F --(freebase)

For research purposes. Not for use in-vivo.
3rd Party Analysis;

MSDS;
Link to PubChem;
https://pubchem.ncbi.nlm.nih.gov/compound/142446267
